C18H21IN2OS — CID 42917168
2-[2,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]ethanol iodide (PubChem CID 42917168) has the molecular formula C18H21IN2OS and a molecular weight of 440.35 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]ethanol iodide.
| Compound Name | 2-[2,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]ethanol iodide |
|---|---|
| PubChem CID | 42917168 |
| Molecular Formula | C18H21IN2OS |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-[2,6-dimethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]ethanol iodide |
| SMILES | Cc1cc(/C=C2\Sc3ccccc3N2C)cc(C)[n+]1CCO.[I-] |
| InChI | InChI=1S/C18H21N2OS.HI/c1-13-10-15(11-14(2)20(13)8-9-21)12-18-19(3)16-6-4-5-7-17(16)22-18;/h4-7,10-12,21H,8-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FODMFELZEVZQFW-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|