C22H27N2O2S+ — CID 170996894
6-[2,6-dimethyl-4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 170996894) has the molecular formula C22H27N2O2S+ and a molecular weight of 383.54 g/mol. Its IUPAC name is 6-[2,6-dimethyl-4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2,6-dimethyl-4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 170996894 |
| Molecular Formula | C22H27N2O2S+ |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 6-[2,6-dimethyl-4-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | Cc1cc(/C=C2/Sc3ccccc3N2C)cc(C)[n+]1CCCCCC(=O)O |
| InChI | InChI=1S/C22H26N2O2S/c1-16-13-18(14-17(2)24(16)12-8-4-5-11-22(25)26)15-21-23(3)19-9-6-7-10-20(19)27-21/h6-7,9-10,13-15H,4-5,8,11-12H2,1-3H3/p+1 |
| InChIKey | SYCQWDVNPZFAEV-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|