C24H24N2O2S2 — CID 56694003
(1Z,8Z)-1,8-bis(3-methyl-1,3-benzothiazol-2-ylidene)octane-2,7-dione (PubChem CID 56694003) has the molecular formula C24H24N2O2S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is (1Z,8Z)-1,8-bis(3-methyl-1,3-benzothiazol-2-ylidene)octane-2,7-dione.
| Compound Name | (1Z,8Z)-1,8-bis(3-methyl-1,3-benzothiazol-2-ylidene)octane-2,7-dione |
|---|---|
| PubChem CID | 56694003 |
| Molecular Formula | C24H24N2O2S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (1Z,8Z)-1,8-bis(3-methyl-1,3-benzothiazol-2-ylidene)octane-2,7-dione |
| SMILES | CN1/C(=C/C(=O)CCCCC(=O)/C=C2\Sc3ccccc3N2C)Sc2ccccc21 |
| InChI | InChI=1S/C24H24N2O2S2/c1-25-19-11-5-7-13-21(19)29-23(25)15-17(27)9-3-4-10-18(28)16-24-26(2)20-12-6-8-14-22(20)30-24/h5-8,11-16H,3-4,9-10H2,1-2H3/b23-15-,24-16- |
| InChIKey | HNDDHEMDAHTJRE-MPKYGIEOSA-N |
| XLogP | 5.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|