C13H15NS2 — CID 171377192
(1Z)-3-methyl-1-(3-methyl-1,3-benzothiazol-2-ylidene)butane-2-thione (PubChem CID 171377192) has the molecular formula C13H15NS2 and a molecular weight of 249.40 g/mol. Its IUPAC name is (1Z)-3-methyl-1-(3-methyl-1,3-benzothiazol-2-ylidene)butane-2-thione.
| Compound Name | (1Z)-3-methyl-1-(3-methyl-1,3-benzothiazol-2-ylidene)butane-2-thione |
|---|---|
| PubChem CID | 171377192 |
| Molecular Formula | C13H15NS2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (1Z)-3-methyl-1-(3-methyl-1,3-benzothiazol-2-ylidene)butane-2-thione |
| SMILES | CC(C)C(=S)/C=C1\Sc2ccccc2N1C |
| InChI | InChI=1S/C13H15NS2/c1-9(2)11(15)8-13-14(3)10-6-4-5-7-12(10)16-13/h4-9H,1-3H3/b13-8- |
| InChIKey | CYKDMUDOQWVEQC-JYRVWZFOSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|