C19H13NO2S — CID 4194904
2-[2-(3-methyl-1,3-benzothiazol-2-ylidene)ethylidene]indene-1,3-dione (PubChem CID 4194904) has the molecular formula C19H13NO2S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-[2-(3-methyl-1,3-benzothiazol-2-ylidene)ethylidene]indene-1,3-dione.
| Compound Name | 2-[2-(3-methyl-1,3-benzothiazol-2-ylidene)ethylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 4194904 |
| Molecular Formula | C19H13NO2S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[2-(3-methyl-1,3-benzothiazol-2-ylidene)ethylidene]indene-1,3-dione |
| SMILES | CN1C(=CC=C2C(=O)c3ccccc3C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C19H13NO2S/c1-20-15-8-4-5-9-16(15)23-17(20)11-10-14-18(21)12-6-2-3-7-13(12)19(14)22/h2-11H,1H3 |
| InChIKey | JDDISWGOSAPJKZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|