C11H14NO3PS — CID 13484828
(2Z)-2-(dimethoxyphosphorylmethylidene)-3-methyl-1,3-benzothiazole (PubChem CID 13484828) has the molecular formula C11H14NO3PS and a molecular weight of 271.28 g/mol. Its IUPAC name is (2Z)-2-(dimethoxyphosphorylmethylidene)-3-methyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-(dimethoxyphosphorylmethylidene)-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 13484828 |
| Molecular Formula | C11H14NO3PS |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | (2Z)-2-(dimethoxyphosphorylmethylidene)-3-methyl-1,3-benzothiazole |
| SMILES | COP(=O)(/C=C1\Sc2ccccc2N1C)OC |
| InChI | InChI=1S/C11H14NO3PS/c1-12-9-6-4-5-7-10(9)17-11(12)8-16(13,14-2)15-3/h4-8H,1-3H3/b11-8- |
| InChIKey | IAXHVCZYYJRTCJ-FLIBITNWSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|