C16H13NS2 — CID 71439340
2-(3-methyl-1,3-benzothiazol-2-ylidene)-1-phenylethanethione (PubChem CID 71439340) has the molecular formula C16H13NS2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-(3-methyl-1,3-benzothiazol-2-ylidene)-1-phenylethanethione.
| Compound Name | 2-(3-methyl-1,3-benzothiazol-2-ylidene)-1-phenylethanethione |
|---|---|
| PubChem CID | 71439340 |
| Molecular Formula | C16H13NS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-(3-methyl-1,3-benzothiazol-2-ylidene)-1-phenylethanethione |
| SMILES | CN1C(=CC(=S)c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C16H13NS2/c1-17-13-9-5-6-10-15(13)19-16(17)11-14(18)12-7-3-2-4-8-12/h2-11H,1H3 |
| InChIKey | ARGONKSDHSCICC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|