C21H23IN2S2 — CID 170844409
(2Z)-3-methyl-2-[(2E)-2-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]butylidene]-1,3-benzothiazole;hydroiodide (PubChem CID 170844409) has the molecular formula C21H23IN2S2 and a molecular weight of 494.47 g/mol. Its IUPAC name is (2Z)-3-methyl-2-[(2E)-2-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]butylidene]-1,3-benzothiazole;hydroiodide.
| Compound Name | (2Z)-3-methyl-2-[(2E)-2-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]butylidene]-1,3-benzothiazole;hydroiodide |
|---|---|
| PubChem CID | 170844409 |
| Molecular Formula | C21H23IN2S2 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | (2Z)-3-methyl-2-[(2E)-2-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]butylidene]-1,3-benzothiazole;hydroiodide |
| SMILES | CCC(/C=C1\Sc2ccccc2N1C)=C\C1Sc2ccccc2N1C.I |
| InChI | InChI=1S/C21H22N2S2.HI/c1-4-15(13-20-22(2)16-9-5-7-11-18(16)24-20)14-21-23(3)17-10-6-8-12-19(17)25-21;/h5-14,20H,4H2,1-3H3;1H/b15-13+,21-14-; |
| InChIKey | PCVUMDSAOQQXMD-INNWYUGYSA-N |
| XLogP | 6.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|