C17H15NOS — CID 2061022
(2E)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-phenylethanone (PubChem CID 2061022) has the molecular formula C17H15NOS and a molecular weight of 281.38 g/mol. Its IUPAC name is (2E)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-phenylethanone.
| Compound Name | (2E)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-phenylethanone |
|---|---|
| PubChem CID | 2061022 |
| Molecular Formula | C17H15NOS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (2E)-2-(3-ethyl-1,3-benzothiazol-2-ylidene)-1-phenylethanone |
| SMILES | CCN1/C(=C\C(=O)c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C17H15NOS/c1-2-18-14-10-6-7-11-16(14)20-17(18)12-15(19)13-8-4-3-5-9-13/h3-12H,2H2,1H3/b17-12+ |
| InChIKey | HDXLIZUCUNCQPF-SFQUDFHCSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|