C29H27N2S+ — CID 76835307
3-ethyl-2-[3-(1-ethylquinolin-1-ium-4-yl)-2-phenylprop-2-enylidene]-1,3-benzothiazole (PubChem CID 76835307) has the molecular formula C29H27N2S+ and a molecular weight of 435.62 g/mol. Its IUPAC name is 3-ethyl-2-[3-(1-ethylquinolin-1-ium-4-yl)-2-phenylprop-2-enylidene]-1,3-benzothiazole.
| Compound Name | 3-ethyl-2-[3-(1-ethylquinolin-1-ium-4-yl)-2-phenylprop-2-enylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 76835307 |
| Molecular Formula | C29H27N2S+ |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-ethyl-2-[3-(1-ethylquinolin-1-ium-4-yl)-2-phenylprop-2-enylidene]-1,3-benzothiazole |
| SMILES | CCN1C(=CC(=Cc2cc[n+](CC)c3ccccc23)c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C29H27N2S/c1-3-30-19-18-23(25-14-8-9-15-26(25)30)20-24(22-12-6-5-7-13-22)21-29-31(4-2)27-16-10-11-17-28(27)32-29/h5-21H,3-4H2,1-2H3/q+1 |
| InChIKey | BJXCSHVQVBQQPI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|