C22H23N2O3S2+ — CID 6912501
3-[4-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 6912501) has the molecular formula C22H23N2O3S2+ and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-[4-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 6912501 |
| Molecular Formula | C22H23N2O3S2+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3-[4-[(Z)-(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C/c2cc[n+](CCCS(=O)(=O)O)c3ccccc23)Sc2ccccc21 |
| InChI | InChI=1S/C22H22N2O3S2/c1-2-24-20-10-5-6-11-21(20)28-22(24)16-17-12-14-23(13-7-15-29(25,26)27)19-9-4-3-8-18(17)19/h3-6,8-12,14,16H,2,7,13,15H2,1H3/p+1 |
| InChIKey | NWFOOWBBBGNCKO-UHFFFAOYSA-O |
| XLogP | 4.34 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|