C24H26N2S — CID 158866505
carbanide;3-ethyl-2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazole (PubChem CID 158866505) has the molecular formula C24H26N2S and a molecular weight of 374.55 g/mol. Its IUPAC name is carbanide;3-ethyl-2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazole.
| Compound Name | carbanide;3-ethyl-2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 158866505 |
| Molecular Formula | C24H26N2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | carbanide;3-ethyl-2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazole |
| SMILES | CCN1C(=CC=Cc2cc[n+](CC)c3ccccc23)Sc2ccccc21.[CH3-] |
| InChI | InChI=1S/C23H23N2S.CH3/c1-3-24-17-16-18(19-11-5-6-12-20(19)24)10-9-15-23-25(4-2)21-13-7-8-14-22(21)26-23;/h5-17H,3-4H2,1-2H3;1H3/q+1;-1 |
| InChIKey | JBHLPMCUTCHWJE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|