C28H24BrN2S+ — CID 164820468
(2Z)-3-benzyl-2-[(E)-3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazole (PubChem CID 164820468) has the molecular formula C28H24BrN2S+ and a molecular weight of 500.49 g/mol. Its IUPAC name is (2Z)-3-benzyl-2-[(E)-3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazole.
| Compound Name | (2Z)-3-benzyl-2-[(E)-3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazole |
|---|---|
| PubChem CID | 164820468 |
| Molecular Formula | C28H24BrN2S+ |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | (2Z)-3-benzyl-2-[(E)-3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazole |
| SMILES | CC[n+]1ccc(/C=C/C=C2\Sc3ccccc3N2Cc2ccccc2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C28H24BrN2S/c1-2-30-18-17-22(24-16-15-23(29)19-26(24)30)11-8-14-28-31(20-21-9-4-3-5-10-21)25-12-6-7-13-27(25)32-28/h3-19H,2,20H2,1H3/q+1 |
| InChIKey | KBZQWLFROVOURU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|