C22H20BrN2S+ — CID 164820530
(2Z)-2-[(E)-3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-3-methyl-1,3-benzothiazole (PubChem CID 164820530) has the molecular formula C22H20BrN2S+ and a molecular weight of 424.39 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-[(E)-3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 164820530 |
| Molecular Formula | C22H20BrN2S+ |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | (2Z)-2-[(E)-3-(7-bromo-1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-3-methyl-1,3-benzothiazole |
| SMILES | CC[n+]1ccc(/C=C/C=C2\Sc3ccccc3N2C)c2ccc(Br)cc21 |
| InChI | InChI=1S/C22H20BrN2S/c1-3-25-14-13-16(18-12-11-17(23)15-20(18)25)7-6-10-22-24(2)19-8-4-5-9-21(19)26-22/h4-15H,3H2,1-2H3/q+1 |
| InChIKey | ZSSVMRXTEZUXPO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|