C25H23ClN2OS — CID 164820493
2-[(2Z)-2-[(2E,4E)-5-(7-chloro-1-ethylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]ethanolate (PubChem CID 164820493) has the molecular formula C25H23ClN2OS and a molecular weight of 434.99 g/mol. Its IUPAC name is 2-[(2Z)-2-[(2E,4E)-5-(7-chloro-1-ethylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]ethanolate.
| Compound Name | 2-[(2Z)-2-[(2E,4E)-5-(7-chloro-1-ethylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]ethanolate |
|---|---|
| PubChem CID | 164820493 |
| Molecular Formula | C25H23ClN2OS |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[(2Z)-2-[(2E,4E)-5-(7-chloro-1-ethylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]ethanolate |
| SMILES | CC[n+]1ccc(/C=C/C=C/C=C2\Sc3ccccc3N2CC[O-])c2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H23ClN2OS/c1-2-27-15-14-19(21-13-12-20(26)18-23(21)27)8-4-3-5-11-25-28(16-17-29)22-9-6-7-10-24(22)30-25/h3-15,18H,2,16-17H2,1H3 |
| InChIKey | CHBVHIQYEXTLFS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|