C23H23N2OS+ — CID 164979614
2-[2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanol (PubChem CID 164979614) has the molecular formula C23H23N2OS+ and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-[2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanol.
| Compound Name | 2-[2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 164979614 |
| Molecular Formula | C23H23N2OS+ |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-[2-[3-(1-ethylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]ethanol |
| SMILES | CC[n+]1ccc(C=CC=C2Sc3ccccc3N2CCO)c2ccccc21 |
| InChI | InChI=1S/C23H23N2OS/c1-2-24-15-14-18(19-9-3-4-10-20(19)24)8-7-13-23-25(16-17-26)21-11-5-6-12-22(21)27-23/h3-15,26H,2,16-17H2,1H3/q+1 |
| InChIKey | AVWYBPZOBMZIGQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|