C22H21BF4N2OS — CID 73012316
2-[4-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethanol tetrafluoroborate (PubChem CID 73012316) has the molecular formula C22H21BF4N2OS and a molecular weight of 448.29 g/mol. Its IUPAC name is 2-[4-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethanol tetrafluoroborate.
| Compound Name | 2-[4-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethanol tetrafluoroborate |
|---|---|
| PubChem CID | 73012316 |
| Molecular Formula | C22H21BF4N2OS |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-[4-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]ethanol tetrafluoroborate |
| SMILES | CN1C(=CC=Cc2cc[n+](CCO)c3ccccc23)Sc2ccccc21.F[B-](F)(F)F |
| InChI | InChI=1S/C22H21N2OS.BF4/c1-23-20-10-4-5-11-21(20)26-22(23)12-6-7-17-13-14-24(15-16-25)19-9-3-2-8-18(17)19;2-1(3,4)5/h2-14,25H,15-16H2,1H3;/q+1;-1 |
| InChIKey | XHQKRIIPKKHSSY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|