C24H23N2OS+ — CID 164992820
2-[4-[5-(3-methyl-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]quinolin-1-ium-1-yl]ethanol (PubChem CID 164992820) has the molecular formula C24H23N2OS+ and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-[4-[5-(3-methyl-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]quinolin-1-ium-1-yl]ethanol.
| Compound Name | 2-[4-[5-(3-methyl-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]quinolin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 164992820 |
| Molecular Formula | C24H23N2OS+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[4-[5-(3-methyl-1,3-benzothiazol-2-ylidene)penta-1,3-dienyl]quinolin-1-ium-1-yl]ethanol |
| SMILES | CN1C(=CC=CC=Cc2cc[n+](CCO)c3ccccc23)Sc2ccccc21 |
| InChI | InChI=1S/C24H23N2OS/c1-25-22-12-7-8-13-23(22)28-24(25)14-4-2-3-9-19-15-16-26(17-18-27)21-11-6-5-10-20(19)21/h2-16,27H,17-18H2,1H3/q+1 |
| InChIKey | HIBQKJLANTXFIU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|