C20H18BrIN2S — CID 162308315
2-[[1-(2-bromoethyl)quinolin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole iodide (PubChem CID 162308315) has the molecular formula C20H18BrIN2S and a molecular weight of 525.25 g/mol. Its IUPAC name is 2-[[1-(2-bromoethyl)quinolin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole iodide.
| Compound Name | 2-[[1-(2-bromoethyl)quinolin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 162308315 |
| Molecular Formula | C20H18BrIN2S |
| Molecular Weight | 525.25 g/mol |
| Exact Mass | 523.94 |
| IUPAC Name | 2-[[1-(2-bromoethyl)quinolin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole iodide |
| SMILES | CN1C(=Cc2cc[n+](CCBr)c3ccccc23)Sc2ccccc21.[I-] |
| InChI | InChI=1S/C20H18BrN2S.HI/c1-22-18-8-4-5-9-19(18)24-20(22)14-15-10-12-23(13-11-21)17-7-3-2-6-16(15)17;/h2-10,12,14H,11,13H2,1H3;1H/q+1;/p-1 |
| InChIKey | YBYZMJOUZSMKTN-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|