C25H29N3S+2 — CID 153061943
(2Z)-2-[[1-[3-(1,2-dimethylaziridin-1-ium-1-yl)propyl]quinolin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole (PubChem CID 153061943) has the molecular formula C25H29N3S+2 and a molecular weight of 403.60 g/mol. Its IUPAC name is (2Z)-2-[[1-[3-(1,2-dimethylaziridin-1-ium-1-yl)propyl]quinolin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-[[1-[3-(1,2-dimethylaziridin-1-ium-1-yl)propyl]quinolin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 153061943 |
| Molecular Formula | C25H29N3S+2 |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (2Z)-2-[[1-[3-(1,2-dimethylaziridin-1-ium-1-yl)propyl]quinolin-1-ium-4-yl]methylidene]-3-methyl-1,3-benzothiazole |
| SMILES | CC1C[N+]1(C)CCC[n+]1ccc(/C=C2\Sc3ccccc3N2C)c2ccccc21 |
| InChI | InChI=1S/C25H29N3S/c1-19-18-28(19,3)16-8-14-27-15-13-20(21-9-4-5-10-22(21)27)17-25-26(2)23-11-6-7-12-24(23)29-25/h4-7,9-13,15,17,19H,8,14,16,18H2,1-3H3/q+2 |
| InChIKey | QBCHMCPHQSQOKF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|