C23H24BrClN2S — CID 12001046
(2E)-5-chloro-3-methyl-2-[(1-pentylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole bromide (PubChem CID 12001046) has the molecular formula C23H24BrClN2S and a molecular weight of 475.88 g/mol. Its IUPAC name is (2E)-5-chloro-3-methyl-2-[(1-pentylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole bromide.
| Compound Name | (2E)-5-chloro-3-methyl-2-[(1-pentylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole bromide |
|---|---|
| PubChem CID | 12001046 |
| Molecular Formula | C23H24BrClN2S |
| Molecular Weight | 475.88 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | (2E)-5-chloro-3-methyl-2-[(1-pentylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole bromide |
| SMILES | CCCCC[n+]1ccc(/C=C2/Sc3ccc(Cl)cc3N2C)c2ccccc21.[Br-] |
| InChI | InChI=1S/C23H24ClN2S.BrH/c1-3-4-7-13-26-14-12-17(19-8-5-6-9-20(19)26)15-23-25(2)21-16-18(24)10-11-22(21)27-23;/h5-6,8-12,14-16H,3-4,7,13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SJKXCBQVFFBTMG-UHFFFAOYSA-M |
| XLogP | 3.52 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|