C29H37N3S+2 — CID 59128216
butyl-dimethyl-[3-[4-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propyl]azanium (PubChem CID 59128216) has the molecular formula C29H37N3S+2 and a molecular weight of 459.70 g/mol. Its IUPAC name is butyl-dimethyl-[3-[4-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propyl]azanium.
| Compound Name | butyl-dimethyl-[3-[4-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propyl]azanium |
|---|---|
| PubChem CID | 59128216 |
| Molecular Formula | C29H37N3S+2 |
| Molecular Weight | 459.70 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | butyl-dimethyl-[3-[4-[3-(3-methyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propyl]azanium |
| SMILES | CCCC[N+](C)(C)CCC[n+]1ccc(C=CC=C2Sc3ccccc3N2C)c2ccccc21 |
| InChI | InChI=1S/C29H37N3S/c1-5-6-22-32(3,4)23-12-20-31-21-19-24(25-14-7-8-15-26(25)31)13-11-18-29-30(2)27-16-9-10-17-28(27)33-29/h7-11,13-19,21H,5-6,12,20,22-23H2,1-4H3/q+2 |
| InChIKey | LCIFRMVBXXGSMW-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.70 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|