C42H54N5S+3 — CID 59853377
3-[dimethyl-[3-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]propyl]azaniumyl]propyl-[3-[(4E)-4-ethylidenequinolin-1-yl]propyl]-dimethylazanium (PubChem CID 59853377) has the molecular formula C42H54N5S+3 and a molecular weight of 661.00 g/mol. Its IUPAC name is 3-[dimethyl-[3-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]propyl]azaniumyl]propyl-[3-[(4E)-4-ethylidenequinolin-1-yl]propyl]-dimethylazanium.
| Compound Name | 3-[dimethyl-[3-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]propyl]azaniumyl]propyl-[3-[(4E)-4-ethylidenequinolin-1-yl]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 59853377 |
| Molecular Formula | C42H54N5S+3 |
| Molecular Weight | 661.00 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | 3-[dimethyl-[3-[4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]propyl]azaniumyl]propyl-[3-[(4E)-4-ethylidenequinolin-1-yl]propyl]-dimethylazanium |
| SMILES | C/C=C1\C=CN(CCC[N+](C)(C)CCC[N+](C)(C)CCC[n+]2ccc(/C=C3\Sc4ccccc4N3C)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C42H54N5S/c1-7-34-23-27-44(38-19-10-8-17-36(34)38)25-14-29-46(3,4)31-16-32-47(5,6)30-15-26-45-28-24-35(37-18-9-11-20-39(37)45)33-42-43(2)40-21-12-13-22-41(40)48-42/h7-13,17-24,27-28,33H,14-16,25-26,29-32H2,1-6H3/q+3/b34-7+ |
| InChIKey | YZLGNQWPIISEHP-DWZKTWONSA-N |
| XLogP | 8.43 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.00 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|