C49H54N6S2+4 — CID 91258830
[7-dimethylazaniumylidene-1,9-bis[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]nonan-3-ylidene]-dimethylazanium (PubChem CID 91258830) has the molecular formula C49H54N6S2+4 and a molecular weight of 791.15 g/mol. Its IUPAC name is [7-dimethylazaniumylidene-1,9-bis[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]nonan-3-ylidene]-dimethylazanium.
| Compound Name | [7-dimethylazaniumylidene-1,9-bis[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]nonan-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 91258830 |
| Molecular Formula | C49H54N6S2+4 |
| Molecular Weight | 791.15 g/mol |
| Exact Mass | 790.38 |
| IUPAC Name | [7-dimethylazaniumylidene-1,9-bis[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinolin-1-ium-1-yl]nonan-3-ylidene]-dimethylazanium |
| SMILES | CN1C(=Cc2cc[n+](CCC(CCCC(CC[n+]3ccc(C=C4Sc5ccccc5N4C)c4ccccc43)=[N+](C)C)=[N+](C)C)c3ccccc23)Sc2ccccc21 |
| InChI | InChI=1S/C49H54N6S2/c1-50(2)38(28-32-54-30-26-36(40-18-7-9-20-42(40)54)34-48-52(5)44-22-11-13-24-46(44)56-48)16-15-17-39(51(3)4)29-33-55-31-27-37(41-19-8-10-21-43(41)55)35-49-53(6)45-23-12-14-25-47(45)57-49/h7-14,18-27,30-31,34-35H,15-17,28-29,32-33H2,1-6H3/q+4 |
| InChIKey | CLZLMOAIMPTJOT-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.15 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|