C27H32N3O2S2+ — CID 140623473
(2Z)-2-[(1-butylquinolin-1-ium-4-yl)methylidene]-3-methyl-6-piperidin-1-ylsulfonyl-1,3-benzothiazole (PubChem CID 140623473) has the molecular formula C27H32N3O2S2+ and a molecular weight of 494.71 g/mol. Its IUPAC name is (2Z)-2-[(1-butylquinolin-1-ium-4-yl)methylidene]-3-methyl-6-piperidin-1-ylsulfonyl-1,3-benzothiazole.
| Compound Name | (2Z)-2-[(1-butylquinolin-1-ium-4-yl)methylidene]-3-methyl-6-piperidin-1-ylsulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 140623473 |
| Molecular Formula | C27H32N3O2S2+ |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (2Z)-2-[(1-butylquinolin-1-ium-4-yl)methylidene]-3-methyl-6-piperidin-1-ylsulfonyl-1,3-benzothiazole |
| SMILES | CCCC[n+]1ccc(/C=C2\Sc3cc(S(=O)(=O)N4CCCCC4)ccc3N2C)c2ccccc21 |
| InChI | InChI=1S/C27H32N3O2S2/c1-3-4-15-29-18-14-21(23-10-6-7-11-24(23)29)19-27-28(2)25-13-12-22(20-26(25)33-27)34(31,32)30-16-8-5-9-17-30/h6-7,10-14,18-20H,3-5,8-9,15-17H2,1-2H3/q+1 |
| InChIKey | OKTVGFDWAKLFPZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 44.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|