C41H53N5O2S2+2 — CID 162167999
2-[[4-[[6-[bis(2-hydroxyethenyl)-piperidin-1-yl-λ4-sulfanyl]-3-methyl-1,3-benzothiazol-2-ylidene]methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]ethyl-trimethylazanium (PubChem CID 162167999) has the molecular formula C41H53N5O2S2+2 and a molecular weight of 712.04 g/mol. Its IUPAC name is 2-[[4-[[6-[bis(2-hydroxyethenyl)-piperidin-1-yl-λ4-sulfanyl]-3-methyl-1,3-benzothiazol-2-ylidene]methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]ethyl-trimethylazanium.
| Compound Name | 2-[[4-[[6-[bis(2-hydroxyethenyl)-piperidin-1-yl-λ4-sulfanyl]-3-methyl-1,3-benzothiazol-2-ylidene]methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 162167999 |
| Molecular Formula | C41H53N5O2S2+2 |
| Molecular Weight | 712.04 g/mol |
| Exact Mass | 711.36 |
| IUPAC Name | 2-[[4-[[6-[bis(2-hydroxyethenyl)-piperidin-1-yl-λ4-sulfanyl]-3-methyl-1,3-benzothiazol-2-ylidene]methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]ethyl-trimethylazanium |
| SMILES | CCCN(CC[N+](C)(C)C)c1cc(C=C2Sc3cc(S(C=CO)(C=CO)N4CCCCC4)ccc3N2C)c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C41H51N5O2S2/c1-6-21-43(24-25-46(3,4)5)40-30-33(36-17-11-12-18-37(36)45(40)34-15-9-7-10-16-34)31-41-42(2)38-20-19-35(32-39(38)49-41)50(28-26-47,29-27-48)44-22-13-8-14-23-44/h7,9-12,15-20,26-32H,6,8,13-14,21-25H2,1-5H3/p+2 |
| InChIKey | ZNJZHIVDMNVCJY-UHFFFAOYSA-P |
| XLogP | 9.20 |
| TPSA | 54.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.04 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|