C37H47N5O2S2+2 — CID 12003636
trimethyl-[2-[[4-[(E)-(3-methyl-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]ethyl]azanium (PubChem CID 12003636) has the molecular formula C37H47N5O2S2+2 and a molecular weight of 657.95 g/mol. Its IUPAC name is trimethyl-[2-[[4-[(E)-(3-methyl-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[4-[(E)-(3-methyl-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]ethyl]azanium |
|---|---|
| PubChem CID | 12003636 |
| Molecular Formula | C37H47N5O2S2+2 |
| Molecular Weight | 657.95 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | trimethyl-[2-[[4-[(E)-(3-methyl-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]ethyl]azanium |
| SMILES | CCCN(CC[N+](C)(C)C)c1cc(/C=C2/Sc3cc(S(=O)(=O)N4CCCCC4)ccc3N2C)c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C37H47N5O2S2/c1-6-21-39(24-25-42(3,4)5)36-26-29(32-17-11-12-18-33(32)41(36)30-15-9-7-10-16-30)27-37-38(2)34-20-19-31(28-35(34)45-37)46(43,44)40-22-13-8-14-23-40/h7,9-12,15-20,26-28H,6,8,13-14,21-25H2,1-5H3/q+2 |
| InChIKey | CCLCORBEMXCMAH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 47.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.95 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|