C33H40N4S+2 — CID 154597265
ethyl-[3-[ethyl-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]-dimethylazanium (PubChem CID 154597265) has the molecular formula C33H40N4S+2 and a molecular weight of 524.78 g/mol. Its IUPAC name is ethyl-[3-[ethyl-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]-dimethylazanium.
| Compound Name | ethyl-[3-[ethyl-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 154597265 |
| Molecular Formula | C33H40N4S+2 |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | ethyl-[3-[ethyl-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]-dimethylazanium |
| SMILES | CCN(CCC[N+](C)(C)CC)c1cc(C=C2Sc3ccccc3N2C)c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C33H40N4S/c1-6-35(22-15-23-37(4,5)7-2)32-24-26(25-33-34(3)30-20-13-14-21-31(30)38-33)28-18-11-12-19-29(28)36(32)27-16-9-8-10-17-27/h8-14,16-21,24-25H,6-7,15,22-23H2,1-5H3/q+2 |
| InChIKey | CZNCJPKONCGIKC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|