C34H42N4OSY+2 — CID 157101601
3-[[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl-trimethylazanium;yttrium (PubChem CID 157101601) has the molecular formula C34H42N4OSY+2 and a molecular weight of 643.71 g/mol. Its IUPAC name is 3-[[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl-trimethylazanium;yttrium.
| Compound Name | 3-[[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl-trimethylazanium;yttrium |
|---|---|
| PubChem CID | 157101601 |
| Molecular Formula | C34H42N4OSY+2 |
| Molecular Weight | 643.71 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | 3-[[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl-trimethylazanium;yttrium |
| SMILES | CCCN(CCC[N+](C)(C)C)c1cc(C=C2Sc3ccccc3N2C)c2ccc(OC)cc2[n+]1-c1ccccc1.[Y] |
| InChI | InChI=1S/C34H42N4OS.Y/c1-7-20-36(21-13-22-38(3,4)5)33-23-26(24-34-35(2)30-16-11-12-17-32(30)40-34)29-19-18-28(39-6)25-31(29)37(33)27-14-9-8-10-15-27;/h8-12,14-19,23-25H,7,13,20-22H2,1-6H3;/q+2; |
| InChIKey | NJGIZUUEKHYOTL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 19.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.71 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|