C41H48N4O2S+2 — CID 154597288
3-[[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl-[(3-methoxyphenyl)methyl]-dimethylazanium (PubChem CID 154597288) has the molecular formula C41H48N4O2S+2 and a molecular weight of 660.93 g/mol. Its IUPAC name is 3-[[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl-[(3-methoxyphenyl)methyl]-dimethylazanium.
| Compound Name | 3-[[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl-[(3-methoxyphenyl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 154597288 |
| Molecular Formula | C41H48N4O2S+2 |
| Molecular Weight | 660.93 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | 3-[[7-methoxy-4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-propylamino]propyl-[(3-methoxyphenyl)methyl]-dimethylazanium |
| SMILES | CCCN(CCC[N+](C)(C)Cc1cccc(OC)c1)c1cc(C=C2Sc3ccccc3N2C)c2ccc(OC)cc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C41H48N4O2S/c1-7-23-43(24-14-25-45(3,4)30-31-15-13-18-34(26-31)46-5)40-27-32(28-41-42(2)37-19-11-12-20-39(37)48-41)36-22-21-35(47-6)29-38(36)44(40)33-16-9-8-10-17-33/h8-13,15-22,26-29H,7,14,23-25,30H2,1-6H3/q+2 |
| InChIKey | VLMAFULNHSSPTF-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 28.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.93 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|