C28H28N3S+ — CID 46912610
N,N-diethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-amine (PubChem CID 46912610) has the molecular formula C28H28N3S+ and a molecular weight of 438.62 g/mol. Its IUPAC name is N,N-diethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-amine.
| Compound Name | N,N-diethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-amine |
|---|---|
| PubChem CID | 46912610 |
| Molecular Formula | C28H28N3S+ |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N,N-diethyl-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-amine |
| SMILES | CCN(CC)c1cc(/C=C2\Sc3ccccc3N2C)c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C28H28N3S/c1-4-30(5-2)27-19-21(20-28-29(3)25-17-11-12-18-26(25)32-28)23-15-9-10-16-24(23)31(27)22-13-7-6-8-14-22/h6-20H,4-5H2,1-3H3/q+1 |
| InChIKey | ZFDVVSSSHDLRJA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|