C25H22ClN3S — CID 66991750
2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride (PubChem CID 66991750) has the molecular formula C25H22ClN3S and a molecular weight of 431.99 g/mol. Its IUPAC name is 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride.
| Compound Name | 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride |
|---|---|
| PubChem CID | 66991750 |
| Molecular Formula | C25H22ClN3S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride |
| SMILES | CCc1nc(C=C2Sc3ccccc3N2C)c2ccccc2[n+]1-c1ccccc1.[Cl-] |
| InChI | InChI=1S/C25H22N3S.ClH/c1-3-24-26-20(17-25-27(2)22-15-9-10-16-23(22)29-25)19-13-7-8-14-21(19)28(24)18-11-5-4-6-12-18;/h4-17H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UOGZMLSVPIWPGX-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|