About 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride
2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride (PubChem CID 66991750) has the molecular formula C25H22ClN3S
and a molecular weight of 431.99 g/mol. Its IUPAC name is 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride.
Molecular Properties
| Compound Name | 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride |
| PubChem CID | 66991750 |
| Molecular Formula | C25H22ClN3S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride |
| SMILES | CCc1nc(C=C2Sc3ccccc3N2C)c2ccccc2[n+]1-c1ccccc1.[Cl-] |
| InChI | InChI=1S/C25H22N3S.ClH/c1-3-24-26-20(17-25-27(2)22-15-9-10-16-23(22)29-25)19-13-7-8-14-21(19)28(24)18-11-5-4-6-12-18;/h4-17H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UOGZMLSVPIWPGX-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride?
The IUPAC name of 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride (CID 66991750) is 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride.
What is the SMILES notation for 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride?
The canonical SMILES for 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride is CCc1nc(C=C2Sc3ccccc3N2C)c2ccccc2[n+]1-c1ccccc1.[Cl-].
What is the InChIKey of 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride?
The InChIKey is UOGZMLSVPIWPGX-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H22N3S.ClH/c1-3-24-26-20(17-25-27(2)22-15-9-10-16-23(22)29-25)19-13-7-8-14-21(19)28(24)18-11-5-4-6-12-18;/h4-17H,3H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride?
2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride has a molecular weight of 431.99 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethyl-1-phenylquinazolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole chloride is sourced from PubChem (CID 66991750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).