C31H36N6S+2 — CID 148901948
diaminomethylidene-[3-[[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]-propylazanium (PubChem CID 148901948) has the molecular formula C31H36N6S+2 and a molecular weight of 524.74 g/mol. Its IUPAC name is diaminomethylidene-[3-[[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]-propylazanium.
| Compound Name | diaminomethylidene-[3-[[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]-propylazanium |
|---|---|
| PubChem CID | 148901948 |
| Molecular Formula | C31H36N6S+2 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | diaminomethylidene-[3-[[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl]-propylazanium |
| SMILES | CCC[N+](CCCNc1cc(C=C2Sc3ccccc3N2C)c2ccccc2[n+]1-c1ccccc1)=C(N)N |
| InChI | InChI=1S/C31H34N6S/c1-3-19-36(31(32)33)20-11-18-34-29-21-23(22-30-35(2)27-16-9-10-17-28(27)38-30)25-14-7-8-15-26(25)37(29)24-12-5-4-6-13-24/h4-10,12-17,21-22H,3,11,18-20H2,1-2H3,(H3,32,33)/p+2 |
| InChIKey | PGYUPFPLRNXXBK-UHFFFAOYSA-P |
| XLogP | 5.15 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|