C30H30N2O3S2 — CID 72573602
3-[2-[(2-butyl-1-phenylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate (PubChem CID 72573602) has the molecular formula C30H30N2O3S2 and a molecular weight of 530.72 g/mol. Its IUPAC name is 3-[2-[(2-butyl-1-phenylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(2-butyl-1-phenylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 72573602 |
| Molecular Formula | C30H30N2O3S2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 3-[2-[(2-butyl-1-phenylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate |
| SMILES | CCCCc1cc(C=C2Sc3ccccc3N2CCCS(=O)(=O)[O-])c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C30H30N2O3S2/c1-2-3-12-25-21-23(26-15-7-8-16-27(26)32(25)24-13-5-4-6-14-24)22-30-31(19-11-20-37(33,34)35)28-17-9-10-18-29(28)36-30/h4-10,13-18,21-22H,2-3,11-12,19-20H2,1H3 |
| InChIKey | GOILCHZNYKJSKI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|