C29H27N4O3S2+ — CID 59832345
3-[(2E)-2-[[1-methyl-2-(1-methylbenzimidazol-2-yl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 59832345) has the molecular formula C29H27N4O3S2+ and a molecular weight of 543.69 g/mol. Its IUPAC name is 3-[(2E)-2-[[1-methyl-2-(1-methylbenzimidazol-2-yl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[[1-methyl-2-(1-methylbenzimidazol-2-yl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59832345 |
| Molecular Formula | C29H27N4O3S2+ |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 3-[(2E)-2-[[1-methyl-2-(1-methylbenzimidazol-2-yl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | Cn1c(-c2cc(/C=C3/Sc4ccccc4N3CCCS(=O)(=O)O)c3ccccc3[n+]2C)nc2ccccc21 |
| InChI | InChI=1S/C29H26N4O3S2/c1-31-23-12-5-3-10-21(23)20(18-26(31)29-30-22-11-4-6-13-24(22)32(29)2)19-28-33(16-9-17-38(34,35)36)25-14-7-8-15-27(25)37-28/h3-8,10-15,18-19H,9,16-17H2,1-2H3/p+1 |
| InChIKey | IZFFQBKVJJVVAN-UHFFFAOYSA-O |
| XLogP | 5.41 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|