C21H21N2O3S2+ — CID 6912477
3-[(2Z)-2-[(1-methylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 6912477) has the molecular formula C21H21N2O3S2+ and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-[(2Z)-2-[(1-methylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-2-[(1-methylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 6912477 |
| Molecular Formula | C21H21N2O3S2+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3-[(2Z)-2-[(1-methylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | C[n+]1c(/C=C2\Sc3ccccc3N2CCCS(=O)(=O)O)ccc2ccccc21 |
| InChI | InChI=1S/C21H20N2O3S2/c1-22-17(12-11-16-7-2-3-8-18(16)22)15-21-23(13-6-14-28(24,25)26)19-9-4-5-10-20(19)27-21/h2-5,7-12,15H,6,13-14H2,1H3/p+1 |
| InChIKey | DOUDUHOZLVBMBY-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|