C32H31N4O4S2+ — CID 59832362
3-[(2E)-2-[[2-[4-methoxy-3-(1-methylpyrazol-3-yl)phenyl]-1-methylquinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 59832362) has the molecular formula C32H31N4O4S2+ and a molecular weight of 599.76 g/mol. Its IUPAC name is 3-[(2E)-2-[[2-[4-methoxy-3-(1-methylpyrazol-3-yl)phenyl]-1-methylquinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[[2-[4-methoxy-3-(1-methylpyrazol-3-yl)phenyl]-1-methylquinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59832362 |
| Molecular Formula | C32H31N4O4S2+ |
| Molecular Weight | 599.76 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 3-[(2E)-2-[[2-[4-methoxy-3-(1-methylpyrazol-3-yl)phenyl]-1-methylquinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | COc1ccc(-c2cc(/C=C3/Sc4ccccc4N3CCCS(=O)(=O)O)c3ccccc3[n+]2C)cc1-c1ccn(C)n1 |
| InChI | InChI=1S/C32H30N4O4S2/c1-34-17-15-26(33-34)25-19-22(13-14-30(25)40-3)29-20-23(24-9-4-5-10-27(24)35(29)2)21-32-36(16-8-18-42(37,38)39)28-11-6-7-12-31(28)41-32/h4-7,9-15,17,19-21H,8,16,18H2,1-3H3/p+1 |
| InChIKey | BKNVEZGZXFIBAP-UHFFFAOYSA-O |
| XLogP | 5.93 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|