C30H27N4S2+ — CID 173477674
3-[2-[[1-methyl-2-(1-phenylimidazol-2-yl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-thiol (PubChem CID 173477674) has the molecular formula C30H27N4S2+ and a molecular weight of 507.71 g/mol. Its IUPAC name is 3-[2-[[1-methyl-2-(1-phenylimidazol-2-yl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-thiol.
| Compound Name | 3-[2-[[1-methyl-2-(1-phenylimidazol-2-yl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-thiol |
|---|---|
| PubChem CID | 173477674 |
| Molecular Formula | C30H27N4S2+ |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 3-[2-[[1-methyl-2-(1-phenylimidazol-2-yl)quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-thiol |
| SMILES | C[n+]1c(-c2nccn2-c2ccccc2)cc(C=C2Sc3ccccc3N2CCCS)c2ccccc21 |
| InChI | InChI=1S/C30H26N4S2/c1-32-25-13-6-5-12-24(25)22(20-27(32)30-31-16-18-33(30)23-10-3-2-4-11-23)21-29-34(17-9-19-35)26-14-7-8-15-28(26)36-29/h2-8,10-16,18,20-21H,9,17,19H2,1H3/p+1 |
| InChIKey | XBNFRUFHOYLQGB-UHFFFAOYSA-O |
| XLogP | 6.75 |
| TPSA | 24.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|