C24H26N3O2S2+ — CID 118199230
2-amino-3-[3-[2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]propylsulfanyl]propanoic acid (PubChem CID 118199230) has the molecular formula C24H26N3O2S2+ and a molecular weight of 452.63 g/mol. Its IUPAC name is 2-amino-3-[3-[2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]propylsulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[3-[2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]propylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 118199230 |
| Molecular Formula | C24H26N3O2S2+ |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-amino-3-[3-[2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]propylsulfanyl]propanoic acid |
| SMILES | C[n+]1ccc(C=C2Sc3ccccc3N2CCCSCC(N)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C24H25N3O2S2/c1-26-13-11-17(18-7-2-3-8-20(18)26)15-23-27(21-9-4-5-10-22(21)31-23)12-6-14-30-16-19(25)24(28)29/h2-5,7-11,13,15,19H,6,12,14,16,25H2,1H3/p+1 |
| InChIKey | UWVDYABDOXYCHT-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|