About (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole
(2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole (PubChem CID 134100946) has the molecular formula C20H19N2S+
and a molecular weight of 319.45 g/mol. Its IUPAC name is (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole.
Molecular Properties
| Compound Name | (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole |
| PubChem CID | 134100946 |
| Molecular Formula | C20H19N2S+ |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole |
| SMILES | Cc1ccc2c(c1)N(C)/C(=C\c1cc[n+](C)c3ccccc13)S2 |
| InChI | InChI=1S/C20H19N2S/c1-14-8-9-19-18(12-14)22(3)20(23-19)13-15-10-11-21(2)17-7-5-4-6-16(15)17/h4-13H,1-3H3/q+1 |
| InChIKey | JDAXBLZJXPUFFO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole?
The IUPAC name of (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole (CID 134100946) is (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole.
What is the SMILES notation for (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole?
The canonical SMILES for (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole is Cc1ccc2c(c1)N(C)/C(=C\c1cc[n+](C)c3ccccc13)S2.
What is the InChIKey of (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole?
The InChIKey is JDAXBLZJXPUFFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N2S/c1-14-8-9-19-18(12-14)22(3)20(23-19)13-15-10-11-21(2)17-7-5-4-6-16(15)17/h4-13H,1-3H3/q+1.
What are the key properties of (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole?
(2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole has a molecular weight of 319.45 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,5-dimethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazole is sourced from PubChem (CID 134100946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).