C25H30N3O2S2+ — CID 158713482
methane;3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-6-piperidin-1-ylsulfonyl-1,3-benzothiazole (PubChem CID 158713482) has the molecular formula C25H30N3O2S2+ and a molecular weight of 468.67 g/mol. Its IUPAC name is methane;3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-6-piperidin-1-ylsulfonyl-1,3-benzothiazole.
| Compound Name | methane;3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-6-piperidin-1-ylsulfonyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 158713482 |
| Molecular Formula | C25H30N3O2S2+ |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | methane;3-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-6-piperidin-1-ylsulfonyl-1,3-benzothiazole |
| SMILES | C.CN1C(=Cc2cc[n+](C)c3ccccc23)Sc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C24H26N3O2S2.CH4/c1-25-15-12-18(20-8-4-5-9-21(20)25)16-24-26(2)22-11-10-19(17-23(22)30-24)31(28,29)27-13-6-3-7-14-27;/h4-5,8-12,15-17H,3,6-7,13-14H2,1-2H3;1H4/q+1; |
| InChIKey | IJACQBXSLQCAEB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 44.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|