C16H21N2O2S2+ — CID 78049902
3-methyl-6-piperidin-1-ylsulfonyl-2-prop-1-enyl-1,3-benzothiazol-3-ium (PubChem CID 78049902) has the molecular formula C16H21N2O2S2+ and a molecular weight of 337.49 g/mol. Its IUPAC name is 3-methyl-6-piperidin-1-ylsulfonyl-2-prop-1-enyl-1,3-benzothiazol-3-ium.
| Compound Name | 3-methyl-6-piperidin-1-ylsulfonyl-2-prop-1-enyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 78049902 |
| Molecular Formula | C16H21N2O2S2+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-methyl-6-piperidin-1-ylsulfonyl-2-prop-1-enyl-1,3-benzothiazol-3-ium |
| SMILES | CC=Cc1sc2cc(S(=O)(=O)N3CCCCC3)ccc2[n+]1C |
| InChI | InChI=1S/C16H21N2O2S2/c1-3-7-16-17(2)14-9-8-13(12-15(14)21-16)22(19,20)18-10-5-4-6-11-18/h3,7-9,12H,4-6,10-11H2,1-2H3/q+1 |
| InChIKey | ZTASWKMMWKQLNB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|