C32H36N3O5S3+ — CID 75251915
4-[2-[2-(9-ethylcarbazol-3-yl)ethenyl]-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 75251915) has the molecular formula C32H36N3O5S3+ and a molecular weight of 638.86 g/mol. Its IUPAC name is 4-[2-[2-(9-ethylcarbazol-3-yl)ethenyl]-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[2-(9-ethylcarbazol-3-yl)ethenyl]-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 75251915 |
| Molecular Formula | C32H36N3O5S3+ |
| Molecular Weight | 638.86 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 4-[2-[2-(9-ethylcarbazol-3-yl)ethenyl]-6-piperidin-1-ylsulfonyl-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CCn1c2ccccc2c2cc(C=Cc3sc4cc(S(=O)(=O)N5CCCCC5)ccc4[n+]3CCCCS(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C32H35N3O5S3/c1-2-34-28-11-5-4-10-26(28)27-22-24(12-15-29(27)34)13-17-32-35(20-8-9-21-42(36,37)38)30-16-14-25(23-31(30)41-32)43(39,40)33-18-6-3-7-19-33/h4-5,10-17,22-23H,2-3,6-9,18-21H2,1H3/p+1 |
| InChIKey | YAVCJMQCWDEIFC-UHFFFAOYSA-O |
| XLogP | 6.33 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.86 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|