C26H21N2O2S+ — CID 59832377
(2E)-2-[(1-benzylquinolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole-6-carboxylic acid (PubChem CID 59832377) has the molecular formula C26H21N2O2S+ and a molecular weight of 425.53 g/mol. Its IUPAC name is (2E)-2-[(1-benzylquinolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | (2E)-2-[(1-benzylquinolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 59832377 |
| Molecular Formula | C26H21N2O2S+ |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | (2E)-2-[(1-benzylquinolin-1-ium-4-yl)methylidene]-3-methyl-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CN1/C(=C\c2cc[n+](Cc3ccccc3)c3ccccc23)Sc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C26H20N2O2S/c1-27-23-12-11-20(26(29)30)15-24(23)31-25(27)16-19-13-14-28(17-18-7-3-2-4-8-18)22-10-6-5-9-21(19)22/h2-16H,17H2,1H3/p+1 |
| InChIKey | QPWGNKJBIPMJPF-UHFFFAOYSA-O |
| XLogP | 5.41 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|