C47H41N2O2PS+2 — CID 178184169
4-[2-[[1-[(4-carboxyphenyl)methyl]quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]butyl-triphenylphosphanium (PubChem CID 178184169) has the molecular formula C47H41N2O2PS+2 and a molecular weight of 728.90 g/mol. Its IUPAC name is 4-[2-[[1-[(4-carboxyphenyl)methyl]quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]butyl-triphenylphosphanium.
| Compound Name | 4-[2-[[1-[(4-carboxyphenyl)methyl]quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]butyl-triphenylphosphanium |
|---|---|
| PubChem CID | 178184169 |
| Molecular Formula | C47H41N2O2PS+2 |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.26 |
| IUPAC Name | 4-[2-[[1-[(4-carboxyphenyl)methyl]quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]butyl-triphenylphosphanium |
| SMILES | O=C(O)c1ccc(C[n+]2ccc(C=C3Sc4ccccc4N3CCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C47H40N2O2PS/c50-47(51)37-28-26-36(27-29-37)35-48-32-30-38(42-22-10-11-23-43(42)48)34-46-49(44-24-12-13-25-45(44)53-46)31-14-15-33-52(39-16-4-1-5-17-39,40-18-6-2-7-19-40)41-20-8-3-9-21-41/h1-13,16-30,32,34H,14-15,31,33,35H2/q+1/p+1 |
| InChIKey | ZLZGSLWWEZUSHE-UHFFFAOYSA-O |
| XLogP | 9.56 |
| TPSA | 44.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|