C33H47N4O4S+ — CID 164844441
2-[4-[(2E)-2-[[1-[4-[bis(2-hydroxyethyl)amino]butyl]quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]butyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 164844441) has the molecular formula C33H47N4O4S+ and a molecular weight of 595.83 g/mol. Its IUPAC name is 2-[4-[(2E)-2-[[1-[4-[bis(2-hydroxyethyl)amino]butyl]quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]butyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[4-[(2E)-2-[[1-[4-[bis(2-hydroxyethyl)amino]butyl]quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]butyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 164844441 |
| Molecular Formula | C33H47N4O4S+ |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | 2-[4-[(2E)-2-[[1-[4-[bis(2-hydroxyethyl)amino]butyl]quinolin-1-ium-4-yl]methylidene]-1,3-benzothiazol-3-yl]butyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | OCCN(CCO)CCCCN1/C(=C\c2cc[n+](CCCCN(CCO)CCO)c3ccccc23)Sc2ccccc21 |
| InChI | InChI=1S/C33H47N4O4S/c38-23-19-34(20-24-39)14-5-7-16-36-18-13-28(29-9-1-2-10-30(29)36)27-33-37(31-11-3-4-12-32(31)42-33)17-8-6-15-35(21-25-40)22-26-41/h1-4,9-13,18,27,38-41H,5-8,14-17,19-26H2/q+1 |
| InChIKey | MXILMICQHIRRDQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|