C35H37N2O2S+ — CID 164844431
4-[(2E)-2-[(2Z,4E)-5-[1-(4-hydroxybutyl)quinolin-1-ium-4-yl]-3-phenylpenta-2,4-dienylidene]-1,3-benzothiazol-3-yl]butan-1-ol (PubChem CID 164844431) has the molecular formula C35H37N2O2S+ and a molecular weight of 549.76 g/mol. Its IUPAC name is 4-[(2E)-2-[(2Z,4E)-5-[1-(4-hydroxybutyl)quinolin-1-ium-4-yl]-3-phenylpenta-2,4-dienylidene]-1,3-benzothiazol-3-yl]butan-1-ol.
| Compound Name | 4-[(2E)-2-[(2Z,4E)-5-[1-(4-hydroxybutyl)quinolin-1-ium-4-yl]-3-phenylpenta-2,4-dienylidene]-1,3-benzothiazol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 164844431 |
| Molecular Formula | C35H37N2O2S+ |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | 4-[(2E)-2-[(2Z,4E)-5-[1-(4-hydroxybutyl)quinolin-1-ium-4-yl]-3-phenylpenta-2,4-dienylidene]-1,3-benzothiazol-3-yl]butan-1-ol |
| SMILES | OCCCCN1/C(=C\C=C(\C=C\c2cc[n+](CCCCO)c3ccccc23)c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C35H37N2O2S/c38-26-10-8-23-36-25-22-30(31-14-4-5-15-32(31)36)19-18-29(28-12-2-1-3-13-28)20-21-35-37(24-9-11-27-39)33-16-6-7-17-34(33)40-35/h1-7,12-22,25,38-39H,8-11,23-24,26-27H2/q+1 |
| InChIKey | TZMBTKSRIMOFRV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|