C27H26N2O2S — CID 59931783
2-[(2Z)-2-[(2Z,4E)-3-ethyl-5-(1-ethylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]acetate (PubChem CID 59931783) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is 2-[(2Z)-2-[(2Z,4E)-3-ethyl-5-(1-ethylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]acetate.
| Compound Name | 2-[(2Z)-2-[(2Z,4E)-3-ethyl-5-(1-ethylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 59931783 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[(2Z)-2-[(2Z,4E)-3-ethyl-5-(1-ethylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCC(=C/C=C1\Sc2ccccc2N1CC(=O)[O-])/C=C/c1cc[n+](CC)c2ccccc12 |
| InChI | InChI=1S/C27H26N2O2S/c1-3-20(13-15-21-17-18-28(4-2)23-10-6-5-9-22(21)23)14-16-26-29(19-27(30)31)24-11-7-8-12-25(24)32-26/h5-18H,3-4,19H2,1-2H3 |
| InChIKey | ZFDQDMCCEBQTCR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|