C28H31IN2S — CID 14618190
(2Z)-3-ethyl-2-[(2E,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-5,6-dimethyl-1,3-benzothiazole iodide (PubChem CID 14618190) has the molecular formula C28H31IN2S and a molecular weight of 554.54 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(2E,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-5,6-dimethyl-1,3-benzothiazole iodide.
| Compound Name | (2Z)-3-ethyl-2-[(2E,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-5,6-dimethyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 14618190 |
| Molecular Formula | C28H31IN2S |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | (2Z)-3-ethyl-2-[(2E,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-5,6-dimethyl-1,3-benzothiazole iodide |
| SMILES | CCN1/C(=C/C=C(C)/C=C/c2cc[n+](CC)c3ccccc23)Sc2cc(C)c(C)cc21.[I-] |
| InChI | InChI=1S/C28H31N2S.HI/c1-6-29-17-16-23(24-10-8-9-11-25(24)29)14-12-20(3)13-15-28-30(7-2)26-18-21(4)22(5)19-27(26)31-28;/h8-19H,6-7H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | JJAMIIQYAYSGMQ-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|