C22H27N2O+ — CID 59953995
(2Z)-3-ethyl-2-[(2E,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-1,3-oxazolidine (PubChem CID 59953995) has the molecular formula C22H27N2O+ and a molecular weight of 335.47 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(2E,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-1,3-oxazolidine.
| Compound Name | (2Z)-3-ethyl-2-[(2E,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-1,3-oxazolidine |
|---|---|
| PubChem CID | 59953995 |
| Molecular Formula | C22H27N2O+ |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (2Z)-3-ethyl-2-[(2E,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-methylpenta-2,4-dienylidene]-1,3-oxazolidine |
| SMILES | CCN1CCO/C1=C\C=C(C)\C=C\c1cc[n+](CC)c2ccccc12 |
| InChI | InChI=1S/C22H27N2O/c1-4-23-15-14-19(20-8-6-7-9-21(20)23)12-10-18(3)11-13-22-24(5-2)16-17-25-22/h6-15H,4-5,16-17H2,1-3H3/q+1 |
| InChIKey | ARJJIZCGHCWOKN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|